C20H19ClN2O5 — CID 87793698
methyl (1S,4R)-2-carbonochloridoyl-4-(phenylmethoxycarbonylamino)-3,4-dihydro-1H-isoquinoline-1-carboxylate (PubChem CID 87793698) has the molecular formula C20H19ClN2O5 and a molecular weight of 402.83 g/mol. Its IUPAC name is methyl (1S,4R)-2-carbonochloridoyl-4-(phenylmethoxycarbonylamino)-3,4-dihydro-1H-isoquinoline-1-carboxylate.
| Compound Name | methyl (1S,4R)-2-carbonochloridoyl-4-(phenylmethoxycarbonylamino)-3,4-dihydro-1H-isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 87793698 |
| Molecular Formula | C20H19ClN2O5 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | methyl (1S,4R)-2-carbonochloridoyl-4-(phenylmethoxycarbonylamino)-3,4-dihydro-1H-isoquinoline-1-carboxylate |
| SMILES | COC(=O)[C@@H]1c2ccccc2[C@@H](NC(=O)OCc2ccccc2)CN1C(=O)Cl |
| InChI | InChI=1S/C20H19ClN2O5/c1-27-18(24)17-15-10-6-5-9-14(15)16(11-23(17)19(21)25)22-20(26)28-12-13-7-3-2-4-8-13/h2-10,16-17H,11-12H2,1H3,(H,22,26)/t16-,17-/m0/s1 |
| InChIKey | LEHIDTWFCZXXOL-IRXDYDNUSA-N |
| XLogP | 3.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|