C16H20N2O5 — CID 71228630
methyl 2-[(3R)-2-oxo-3-(phenylmethoxycarbonylamino)piperidin-1-yl]acetate (PubChem CID 71228630) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is methyl 2-[(3R)-2-oxo-3-(phenylmethoxycarbonylamino)piperidin-1-yl]acetate.
| Compound Name | methyl 2-[(3R)-2-oxo-3-(phenylmethoxycarbonylamino)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 71228630 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 2-[(3R)-2-oxo-3-(phenylmethoxycarbonylamino)piperidin-1-yl]acetate |
| SMILES | COC(=O)CN1CCC[C@@H](NC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C16H20N2O5/c1-22-14(19)10-18-9-5-8-13(15(18)20)17-16(21)23-11-12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3,(H,17,21)/t13-/m1/s1 |
| InChIKey | AMZGSSMNBUBBDV-CYBMUJFWSA-N |
| XLogP | 1.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |