C19H19IN2O3 — CID 58778178
benzyl N-[(3S)-1-(4-iodophenyl)-2-oxopiperidin-3-yl]carbamate (PubChem CID 58778178) has the molecular formula C19H19IN2O3 and a molecular weight of 450.28 g/mol. Its IUPAC name is benzyl N-[(3S)-1-(4-iodophenyl)-2-oxopiperidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-1-(4-iodophenyl)-2-oxopiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 58778178 |
| Molecular Formula | C19H19IN2O3 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | benzyl N-[(3S)-1-(4-iodophenyl)-2-oxopiperidin-3-yl]carbamate |
| SMILES | O=C(N[C@H]1CCCN(c2ccc(I)cc2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19IN2O3/c20-15-8-10-16(11-9-15)22-12-4-7-17(18(22)23)21-19(24)25-13-14-5-2-1-3-6-14/h1-3,5-6,8-11,17H,4,7,12-13H2,(H,21,24)/t17-/m0/s1 |
| InChIKey | UBVYYWAVEBBTRN-KRWDZBQOSA-N |
| XLogP | 3.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|