C28H42N6O9 — CID 149433891
benzyl N-[(3S)-1-[2-[2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]oxyethylamino]-2-oxoethyl]-2-oxopiperidin-3-yl]carbamate (PubChem CID 149433891) has the molecular formula C28H42N6O9 and a molecular weight of 606.68 g/mol. Its IUPAC name is benzyl N-[(3S)-1-[2-[2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]oxyethylamino]-2-oxoethyl]-2-oxopiperidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-1-[2-[2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]oxyethylamino]-2-oxoethyl]-2-oxopiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 149433891 |
| Molecular Formula | C28H42N6O9 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | benzyl N-[(3S)-1-[2-[2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]oxyethylamino]-2-oxoethyl]-2-oxopiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NOCCNC(=O)CN1CCC[C@H](NC(=O)OCc2ccccc2)C1=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H42N6O9/c1-27(2,3)42-25(38)31-23(32-26(39)43-28(4,5)6)33-41-16-14-29-21(35)17-34-15-10-13-20(22(34)36)30-24(37)40-18-19-11-8-7-9-12-19/h7-9,11-12,20H,10,13-18H2,1-6H3,(H,29,35)(H,30,37)(H2,31,32,33,38,39)/t20-/m0/s1 |
| InChIKey | DAXQKFOSHSPOQX-FQEVSTJZSA-N |
| XLogP | 2.36 |
| TPSA | 185.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|