C19H26N4O6 — CID 11281209
tert-butyl N-[1-[2-[(4-nitrophenyl)methylamino]-2-oxoethyl]-2-oxopiperidin-3-yl]carbamate (PubChem CID 11281209) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[(4-nitrophenyl)methylamino]-2-oxoethyl]-2-oxopiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[(4-nitrophenyl)methylamino]-2-oxoethyl]-2-oxopiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 11281209 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | tert-butyl N-[1-[2-[(4-nitrophenyl)methylamino]-2-oxoethyl]-2-oxopiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(CC(=O)NCc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C19H26N4O6/c1-19(2,3)29-18(26)21-15-5-4-10-22(17(15)25)12-16(24)20-11-13-6-8-14(9-7-13)23(27)28/h6-9,15H,4-5,10-12H2,1-3H3,(H,20,24)(H,21,26) |
| InChIKey | RTBTZKQXADRUTR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|