C30H36N6O8 — CID 11786804
N,N'-bis[1-[(4-nitrophenyl)methyl]-2-oxopiperidin-3-yl]hexanediamide (PubChem CID 11786804) has the molecular formula C30H36N6O8 and a molecular weight of 608.65 g/mol. Its IUPAC name is N,N'-bis[1-[(4-nitrophenyl)methyl]-2-oxopiperidin-3-yl]hexanediamide.
| Compound Name | N,N'-bis[1-[(4-nitrophenyl)methyl]-2-oxopiperidin-3-yl]hexanediamide |
|---|---|
| PubChem CID | 11786804 |
| Molecular Formula | C30H36N6O8 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | N,N'-bis[1-[(4-nitrophenyl)methyl]-2-oxopiperidin-3-yl]hexanediamide |
| SMILES | O=C(CCCCC(=O)NC1CCCN(Cc2ccc([N+](=O)[O-])cc2)C1=O)NC1CCCN(Cc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C30H36N6O8/c37-27(31-25-5-3-17-33(29(25)39)19-21-9-13-23(14-10-21)35(41)42)7-1-2-8-28(38)32-26-6-4-18-34(30(26)40)20-22-11-15-24(16-12-22)36(43)44/h9-16,25-26H,1-8,17-20H2,(H,31,37)(H,32,38) |
| InChIKey | QJWMPMFTHVZQCO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 185.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|