C17H20FN3O7 — CID 15416776
(4-nitrophenyl)methyl 2-fluoro-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]acetate (PubChem CID 15416776) has the molecular formula C17H20FN3O7 and a molecular weight of 397.36 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-fluoro-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-fluoro-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 15416776 |
| Molecular Formula | C17H20FN3O7 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (4-nitrophenyl)methyl 2-fluoro-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoazetidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN(C(F)C(=O)OCc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C17H20FN3O7/c1-17(2,3)28-16(24)19-12-8-20(14(12)22)13(18)15(23)27-9-10-4-6-11(7-5-10)21(25)26/h4-7,12-13H,8-9H2,1-3H3,(H,19,24)/t12-,13?/m0/s1 |
| InChIKey | XBPYZTUXUFROLL-UEWDXFNNSA-N |
| XLogP | 1.67 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|