C18H22N2O6 — CID 11279924
cis-(4-nitrophenyl)methyl (1R,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate (PubChem CID 11279924) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is cis-(4-nitrophenyl)methyl (1R,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate.
| Compound Name | cis-(4-nitrophenyl)methyl (1R,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11279924 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | cis-(4-nitrophenyl)methyl (1R,2R)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@]1(NC(=O)OC(C)(C)C)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H22N2O6/c1-5-13-10-18(13,19-16(22)26-17(2,3)4)15(21)25-11-12-6-8-14(9-7-12)20(23)24/h5-9,13H,1,10-11H2,2-4H3,(H,19,22)/t13-,18+/m0/s1 |
| InChIKey | ZJCGHOCHZHTMCI-SCLBCKFNSA-N |
| XLogP | 3.11 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|