C24H29N3O9 — CID 143158318
tert-butyl 2-[[(1R)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate (PubChem CID 143158318) has the molecular formula C24H29N3O9 and a molecular weight of 503.51 g/mol. Its IUPAC name is tert-butyl 2-[[(1R)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(1R)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143158318 |
| Molecular Formula | C24H29N3O9 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | tert-butyl 2-[[(1R)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
| SMILES | C=CC1C[C@]1(NC(=O)C1CC(OC(=O)c2ccc([N+](=O)[O-])cc2)CN1C(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C24H29N3O9/c1-6-15-12-24(15,21(30)34-5)25-19(28)18-11-17(13-26(18)22(31)36-23(2,3)4)35-20(29)14-7-9-16(10-8-14)27(32)33/h6-10,15,17-18H,1,11-13H2,2-5H3,(H,25,28)/t15?,17?,18?,24-/m1/s1 |
| InChIKey | XQAGWUAHPDTAKR-MOEFXMCISA-N |
| XLogP | 2.36 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|