C29H37N3O8 — CID 59497221
[(3S,5S)-5-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-1-non-8-enoylpyrrolidin-3-yl] 4-nitrobenzoate (PubChem CID 59497221) has the molecular formula C29H37N3O8 and a molecular weight of 555.63 g/mol. Its IUPAC name is [(3S,5S)-5-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-1-non-8-enoylpyrrolidin-3-yl] 4-nitrobenzoate.
| Compound Name | [(3S,5S)-5-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-1-non-8-enoylpyrrolidin-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 59497221 |
| Molecular Formula | C29H37N3O8 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | [(3S,5S)-5-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-1-non-8-enoylpyrrolidin-3-yl] 4-nitrobenzoate |
| SMILES | C=CCCCCCCC(=O)N1C[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C[C@H]1C(=O)N[C@]1(C(=O)OCC)C[C@H]1C=C |
| InChI | InChI=1S/C29H37N3O8/c1-4-7-8-9-10-11-12-25(33)31-19-23(40-27(35)20-13-15-22(16-14-20)32(37)38)17-24(31)26(34)30-29(18-21(29)5-2)28(36)39-6-3/h4-5,13-16,21,23-24H,1-2,6-12,17-19H2,3H3,(H,30,34)/t21-,23+,24+,29-/m1/s1 |
| InChIKey | AELBXYWNLDROKQ-KXPNLRIWSA-N |
| XLogP | 3.87 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|