C31H40N4O9 — CID 59104339
[(3S,5S)-5-[[(1R,2S)-1-acetyl-2-ethenylcyclopropyl]carbamoyl]-1-[(2S)-2-(cyclopentyloxycarbonylamino)-3,3-dimethylbutanoyl]pyrrolidin-3-yl] 4-nitrobenzoate (PubChem CID 59104339) has the molecular formula C31H40N4O9 and a molecular weight of 612.68 g/mol. Its IUPAC name is [(3S,5S)-5-[[(1R,2S)-1-acetyl-2-ethenylcyclopropyl]carbamoyl]-1-[(2S)-2-(cyclopentyloxycarbonylamino)-3,3-dimethylbutanoyl]pyrrolidin-3-yl] 4-nitrobenzoate.
| Compound Name | [(3S,5S)-5-[[(1R,2S)-1-acetyl-2-ethenylcyclopropyl]carbamoyl]-1-[(2S)-2-(cyclopentyloxycarbonylamino)-3,3-dimethylbutanoyl]pyrrolidin-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 59104339 |
| Molecular Formula | C31H40N4O9 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | [(3S,5S)-5-[[(1R,2S)-1-acetyl-2-ethenylcyclopropyl]carbamoyl]-1-[(2S)-2-(cyclopentyloxycarbonylamino)-3,3-dimethylbutanoyl]pyrrolidin-3-yl] 4-nitrobenzoate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C31H40N4O9/c1-6-20-16-31(20,18(2)36)33-26(37)24-15-23(43-28(39)19-11-13-21(14-12-19)35(41)42)17-34(24)27(38)25(30(3,4)5)32-29(40)44-22-9-7-8-10-22/h6,11-14,20,22-25H,1,7-10,15-17H2,2-5H3,(H,32,40)(H,33,37)/t20-,23+,24+,25-,31+/m1/s1 |
| InChIKey | ZOAXEGIGZWUZPR-JIOXPMLASA-N |
| XLogP | 3.45 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|