C25H31N3O9 — CID 59165437
tert-butyl (2S,4R)-2-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate (PubChem CID 59165437) has the molecular formula C25H31N3O9 and a molecular weight of 517.54 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59165437 |
| Molecular Formula | C25H31N3O9 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | tert-butyl (2S,4R)-2-[[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]carbamoyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)CN1C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C25H31N3O9/c1-6-16-13-25(16,22(31)35-7-2)26-20(29)19-12-18(14-27(19)23(32)37-24(3,4)5)36-21(30)15-8-10-17(11-9-15)28(33)34/h6,8-11,16,18-19H,1,7,12-14H2,2-5H3,(H,26,29)/t16-,18-,19+,25-/m1/s1 |
| InChIKey | MFPNGSKEDSSMEI-VDQVMUTISA-N |
| XLogP | 2.75 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|