C26H32N2O9 — CID 58535055
tert-butyl (2S,4S)-2-[2-[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]acetyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate (PubChem CID 58535055) has the molecular formula C26H32N2O9 and a molecular weight of 516.55 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[2-[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]acetyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-[2-[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]acetyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58535055 |
| Molecular Formula | C26H32N2O9 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | tert-butyl (2S,4S)-2-[2-[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]acetyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(CC(=O)[C@@H]1C[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)CN1C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C26H32N2O9/c1-6-17-13-26(17,23(31)35-7-2)14-21(29)20-12-19(15-27(20)24(32)37-25(3,4)5)36-22(30)16-8-10-18(11-9-16)28(33)34/h6,8-11,17,19-20H,1,7,12-15H2,2-5H3/t17-,19+,20+,26-/m1/s1 |
| InChIKey | UOCOUIWJRZBICS-YMIBRCGYSA-N |
| XLogP | 3.84 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|