C25H32BrNO8S — CID 158736256
tert-butyl (2S,4S)-4-(4-bromophenyl)sulfonyloxy-2-[2-[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]acetyl]pyrrolidine-1-carboxylate (PubChem CID 158736256) has the molecular formula C25H32BrNO8S and a molecular weight of 586.50 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-(4-bromophenyl)sulfonyloxy-2-[2-[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]acetyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-(4-bromophenyl)sulfonyloxy-2-[2-[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]acetyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 158736256 |
| Molecular Formula | C25H32BrNO8S |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | tert-butyl (2S,4S)-4-(4-bromophenyl)sulfonyloxy-2-[2-[(1R,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]acetyl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(CC(=O)[C@@H]1C[C@H](OS(=O)(=O)c2ccc(Br)cc2)CN1C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C25H32BrNO8S/c1-6-16-13-25(16,22(29)33-7-2)14-21(28)20-12-18(15-27(20)23(30)34-24(3,4)5)35-36(31,32)19-10-8-17(26)9-11-19/h6,8-11,16,18,20H,1,7,12-15H2,2-5H3/t16-,18+,20+,25-/m1/s1 |
| InChIKey | RYIVWYQKTAPEPT-JPSJHZPQSA-N |
| XLogP | 4.25 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|