C22H27ClN2O8 — CID 171535923
1-O-tert-butyl 2-O-methyl (2S,4R)-2-[2-(chloromethyl)prop-2-enyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1,2-dicarboxylate (PubChem CID 171535923) has the molecular formula C22H27ClN2O8 and a molecular weight of 482.92 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-2-[2-(chloromethyl)prop-2-enyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-2-[2-(chloromethyl)prop-2-enyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 171535923 |
| Molecular Formula | C22H27ClN2O8 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-2-[2-(chloromethyl)prop-2-enyl]-4-(4-nitrobenzoyl)oxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=C(CCl)C[C@@]1(C(=O)OC)C[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27ClN2O8/c1-14(12-23)10-22(19(27)31-5)11-17(13-24(22)20(28)33-21(2,3)4)32-18(26)15-6-8-16(9-7-15)25(29)30/h6-9,17H,1,10-13H2,2-5H3/t17-,22+/m1/s1 |
| InChIKey | QGZIWYPAAVYRPT-VGSWGCGISA-N |
| XLogP | 3.86 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|