C21H38ClNO5Si — CID 171792786
1-O-tert-butyl 2-O-methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(chloromethyl)prop-2-enyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 171792786) has the molecular formula C21H38ClNO5Si and a molecular weight of 448.08 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(chloromethyl)prop-2-enyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(chloromethyl)prop-2-enyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 171792786 |
| Molecular Formula | C21H38ClNO5Si |
| Molecular Weight | 448.08 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(chloromethyl)prop-2-enyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C=C(CCl)C[C@]1(C(=O)OC)C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H38ClNO5Si/c1-15(13-22)11-21(17(24)26-8)12-16(28-29(9,10)20(5,6)7)14-23(21)18(25)27-19(2,3)4/h16H,1,11-14H2,2-10H3/t16-,21-/m1/s1 |
| InChIKey | YOQQDPBAIWJYMW-IIBYNOLFSA-N |
| XLogP | 5.11 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.08 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|