C20H38N2O5Si — CID 69446341
(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(cyclohexylamino)ethyl]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 69446341) has the molecular formula C20H38N2O5Si and a molecular weight of 414.62 g/mol. Its IUPAC name is (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(cyclohexylamino)ethyl]pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(cyclohexylamino)ethyl]pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 69446341 |
| Molecular Formula | C20H38N2O5Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-(cyclohexylamino)ethyl]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CN(C(=O)O)C(CCNC2CCCCC2)(C(=O)O)C1 |
| InChI | InChI=1S/C20H38N2O5Si/c1-19(2,3)28(4,5)27-16-13-20(17(23)24,22(14-16)18(25)26)11-12-21-15-9-7-6-8-10-15/h15-16,21H,6-14H2,1-5H3,(H,23,24)(H,25,26)/t16-,20?/m1/s1 |
| InChIKey | VXYCIYZKTDSBIB-QRIPLOBPSA-N |
| XLogP | 3.90 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|