C14H26O5Si — CID 175981383
4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1,1-dicarboxylic acid (PubChem CID 175981383) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1,1-dicarboxylic acid.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 175981383 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1,1-dicarboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(C(=O)O)(C(=O)O)CC1 |
| InChI | InChI=1S/C14H26O5Si/c1-13(2,3)20(4,5)19-10-6-8-14(9-7-10,11(15)16)12(17)18/h10H,6-9H2,1-5H3,(H,15,16)(H,17,18) |
| InChIKey | XTEBDNFAZCEADS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|