C26H52O8Si2 — CID 160745300
4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexane-1-carboxylic acid (PubChem CID 160745300) has the molecular formula C26H52O8Si2 and a molecular weight of 548.87 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 160745300 |
| Molecular Formula | C26H52O8Si2 |
| Molecular Weight | 548.87 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(O)(C(=O)O)CC1.CC(C)(C)[Si](C)(C)OC1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/2C13H26O4Si/c2*1-12(2,3)18(4,5)17-10-6-8-13(16,9-7-10)11(14)15/h2*10,16H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | RWCUCPZYSHJNJF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.87 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|