C13H28O3Si — CID 140956891
[3-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)cyclopentyl]methanol (PubChem CID 140956891) has the molecular formula C13H28O3Si and a molecular weight of 260.45 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)cyclopentyl]methanol.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 140956891 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)cyclopentyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CO)(CO)C1 |
| InChI | InChI=1S/C13H28O3Si/c1-12(2,3)17(4,5)16-11-6-7-13(8-11,9-14)10-15/h11,14-15H,6-10H2,1-5H3 |
| InChIKey | XTCAIHIVKOJMKW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|