C31H60O3Si — CID 140956876
10-[3-[tert-butyl(dimethyl)silyl]oxy-1-(10-oxodecyl)cyclopentyl]decanal (PubChem CID 140956876) has the molecular formula C31H60O3Si and a molecular weight of 508.90 g/mol. Its IUPAC name is 10-[3-[tert-butyl(dimethyl)silyl]oxy-1-(10-oxodecyl)cyclopentyl]decanal.
| Compound Name | 10-[3-[tert-butyl(dimethyl)silyl]oxy-1-(10-oxodecyl)cyclopentyl]decanal |
|---|---|
| PubChem CID | 140956876 |
| Molecular Formula | C31H60O3Si |
| Molecular Weight | 508.90 g/mol |
| Exact Mass | 508.43 |
| IUPAC Name | 10-[3-[tert-butyl(dimethyl)silyl]oxy-1-(10-oxodecyl)cyclopentyl]decanal |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CCCCCCCCCC=O)(CCCCCCCCCC=O)C1 |
| InChI | InChI=1S/C31H60O3Si/c1-30(2,3)35(4,5)34-29-22-25-31(28-29,23-18-14-10-6-8-12-16-20-26-32)24-19-15-11-7-9-13-17-21-27-33/h26-27,29H,6-25,28H2,1-5H3 |
| InChIKey | KUEXFACXKDJSJB-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.90 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|