C36H66O3Si2 — CID 91309041
(5R)-5-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanal (PubChem CID 91309041) has the molecular formula C36H66O3Si2 and a molecular weight of 603.09 g/mol. Its IUPAC name is (5R)-5-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanal.
| Compound Name | (5R)-5-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanal |
|---|---|
| PubChem CID | 91309041 |
| Molecular Formula | C36H66O3Si2 |
| Molecular Weight | 603.09 g/mol |
| Exact Mass | 602.46 |
| IUPAC Name | (5R)-5-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanal |
| SMILES | C[C@H](CCCC=O)[C@H]1CC[C@H]2C(=CC=C3C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C3)CCC[C@]12C |
| InChI | InChI=1S/C36H66O3Si2/c1-27(16-13-14-23-37)32-20-21-33-29(17-15-22-36(32,33)8)19-18-28-24-30(38-40(9,10)34(2,3)4)26-31(25-28)39-41(11,12)35(5,6)7/h18-19,23,27,30-33H,13-17,20-22,24-26H2,1-12H3/t27-,30-,31-,32-,33+,36-/m1/s1 |
| InChIKey | LZRUOWAEUOJECY-OVBCVUPVSA-N |
| XLogP | 11.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.09 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|