C34H62O3Si2 — CID 169180052
(3R)-3-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal (PubChem CID 169180052) has the molecular formula C34H62O3Si2 and a molecular weight of 575.04 g/mol. Its IUPAC name is (3R)-3-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal.
| Compound Name | (3R)-3-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal |
|---|---|
| PubChem CID | 169180052 |
| Molecular Formula | C34H62O3Si2 |
| Molecular Weight | 575.04 g/mol |
| Exact Mass | 574.42 |
| IUPAC Name | (3R)-3-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal |
| SMILES | C[C@H](CC=O)[C@H]1CC[C@H]2/C(=C/C=C3C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C3)CCC[C@]12C |
| InChI | InChI=1S/C34H62O3Si2/c1-25(19-21-35)30-17-18-31-27(14-13-20-34(30,31)8)16-15-26-22-28(36-38(9,10)32(2,3)4)24-29(23-26)37-39(11,12)33(5,6)7/h15-16,21,25,28-31H,13-14,17-20,22-24H2,1-12H3/b27-16+/t25-,28-,29-,30-,31+,34-/m1/s1 |
| InChIKey | LBDJHLBAJOXOMB-ASHDVUFBSA-N |
| XLogP | 10.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.04 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|