C37H66O4Si2 — CID 57122534
cyclopropylmethyl (2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propanoate (PubChem CID 57122534) has the molecular formula C37H66O4Si2 and a molecular weight of 631.10 g/mol. Its IUPAC name is cyclopropylmethyl (2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propanoate.
| Compound Name | cyclopropylmethyl (2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propanoate |
|---|---|
| PubChem CID | 57122534 |
| Molecular Formula | C37H66O4Si2 |
| Molecular Weight | 631.10 g/mol |
| Exact Mass | 630.45 |
| IUPAC Name | cyclopropylmethyl (2S)-2-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propanoate |
| SMILES | C[C@H](C(=O)OCC1CC1)[C@H]1CC[C@H]2C(=CC=C3C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C3)CCC[C@]12C |
| InChI | InChI=1S/C37H66O4Si2/c1-26(34(38)39-25-27-15-16-27)32-19-20-33-29(14-13-21-37(32,33)8)18-17-28-22-30(40-42(9,10)35(2,3)4)24-31(23-28)41-43(11,12)36(5,6)7/h17-18,26-27,30-33H,13-16,19-25H2,1-12H3/t26-,30+,31+,32+,33-,37+/m0/s1 |
| InChIKey | SJXFQXDFMRHGRP-GIJADLHBSA-N |
| XLogP | 10.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.10 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|