C40H66O4Si2 — CID 139760172
benzyl (2S)-2-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propanoate (PubChem CID 139760172) has the molecular formula C40H66O4Si2 and a molecular weight of 667.14 g/mol. Its IUPAC name is benzyl (2S)-2-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propanoate.
| Compound Name | benzyl (2S)-2-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propanoate |
|---|---|
| PubChem CID | 139760172 |
| Molecular Formula | C40H66O4Si2 |
| Molecular Weight | 667.14 g/mol |
| Exact Mass | 666.45 |
| IUPAC Name | benzyl (2S)-2-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propanoate |
| SMILES | C[C@H](C(=O)OCc1ccccc1)[C@H]1CC[C@H]2/C(=C/C=C3C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C3)CCC[C@]12C |
| InChI | InChI=1S/C40H66O4Si2/c1-29(37(41)42-28-30-17-14-13-15-18-30)35-22-23-36-32(19-16-24-40(35,36)8)21-20-31-25-33(43-45(9,10)38(2,3)4)27-34(26-31)44-46(11,12)39(5,6)7/h13-15,17-18,20-21,29,33-36H,16,19,22-28H2,1-12H3/b32-21+/t29-,33+,34+,35+,36-,40+/m0/s1 |
| InChIKey | MBZCFHXETHFACF-LCNAAHLQSA-N |
| XLogP | 11.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.14 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|