C36H64O3Si2 — CID 91602521
4-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylpent-3-enal (PubChem CID 91602521) has the molecular formula C36H64O3Si2 and a molecular weight of 601.08 g/mol. Its IUPAC name is 4-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylpent-3-enal.
| Compound Name | 4-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylpent-3-enal |
|---|---|
| PubChem CID | 91602521 |
| Molecular Formula | C36H64O3Si2 |
| Molecular Weight | 601.08 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | 4-[(1R,3aS,7aR)-4-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylpent-3-enal |
| SMILES | CC(=CC(C)C=O)[C@H]1CC[C@H]2C(=CC=C3C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C3)CCC[C@]12C |
| InChI | InChI=1S/C36H64O3Si2/c1-26(25-37)21-27(2)32-18-19-33-29(15-14-20-36(32,33)9)17-16-28-22-30(38-40(10,11)34(3,4)5)24-31(23-28)39-41(12,13)35(6,7)8/h16-17,21,25-26,30-33H,14-15,18-20,22-24H2,1-13H3/t26?,30-,31-,32-,33+,36-/m1/s1 |
| InChIKey | AQZVEWLRBBPUNM-ZKXIXJFLSA-N |
| XLogP | 10.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.08 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|