C27H44O2Si — CID 11091264
1-[(1S,3aS,4E,7aS)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanone (PubChem CID 11091264) has the molecular formula C27H44O2Si and a molecular weight of 428.73 g/mol. Its IUPAC name is 1-[(1S,3aS,4E,7aS)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanone.
| Compound Name | 1-[(1S,3aS,4E,7aS)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanone |
|---|---|
| PubChem CID | 11091264 |
| Molecular Formula | C27H44O2Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 1-[(1S,3aS,4E,7aS)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethanone |
| SMILES | C=C1CC[C@H](O[Si](C)(C)C(C)(C)C)C/C1=C/C=C1\CCC[C@]2(C)[C@@H](C(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C27H44O2Si/c1-19-11-14-23(29-30(7,8)26(3,4)5)18-22(19)13-12-21-10-9-17-27(6)24(20(2)28)15-16-25(21)27/h12-13,23-25H,1,9-11,14-18H2,2-8H3/b21-12+,22-13-/t23-,24+,25-,27+/m0/s1 |
| InChIKey | PVLKSKYLKZSNHG-GNFNRSOESA-N |
| XLogP | 7.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|