C16H33NO4Si — CID 141208174
[4-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxypropyl)cyclohexyl]carbamic acid (PubChem CID 141208174) has the molecular formula C16H33NO4Si and a molecular weight of 331.53 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxypropyl)cyclohexyl]carbamic acid.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxypropyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 141208174 |
| Molecular Formula | C16H33NO4Si |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxy-1-(3-hydroxypropyl)cyclohexyl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CCCO)(NC(=O)O)CC1 |
| InChI | InChI=1S/C16H33NO4Si/c1-15(2,3)22(4,5)21-13-7-10-16(11-8-13,9-6-12-18)17-14(19)20/h13,17-18H,6-12H2,1-5H3,(H,19,20) |
| InChIKey | OHBPXSQVLIEUBS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|