C14H29NO4Si — CID 174057960
[(1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)cyclohexyl]carbamic acid (PubChem CID 174057960) has the molecular formula C14H29NO4Si and a molecular weight of 303.48 g/mol. Its IUPAC name is [(1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)cyclohexyl]carbamic acid.
| Compound Name | [(1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 174057960 |
| Molecular Formula | C14H29NO4Si |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | [(1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)cyclohexyl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@H](NC(=O)O)[C@@H](CO)C1 |
| InChI | InChI=1S/C14H29NO4Si/c1-14(2,3)20(4,5)19-11-6-7-12(15-13(17)18)10(8-11)9-16/h10-12,15-16H,6-9H2,1-5H3,(H,17,18)/t10-,11-,12+/m1/s1 |
| InChIKey | FTDCMCCZNXFSJR-UTUOFQBUSA-N |
| XLogP | 2.81 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|