C17H33NO3Si — CID 174095652
cis-(1S,2S)-N-[3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-2-(methoxymethyl)cyclopropane-1-carboxamide (PubChem CID 174095652) has the molecular formula C17H33NO3Si and a molecular weight of 327.54 g/mol. Its IUPAC name is cis-(1S,2S)-N-[3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-2-(methoxymethyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-[3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-2-(methoxymethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 174095652 |
| Molecular Formula | C17H33NO3Si |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | cis-(1S,2S)-N-[3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-2-(methoxymethyl)cyclopropane-1-carboxamide |
| SMILES | COC[C@H]1C[C@@H]1C(=O)NC1CCC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H33NO3Si/c1-17(2,3)22(5,6)21-14-8-7-13(10-14)18-16(19)15-9-12(15)11-20-4/h12-15H,7-11H2,1-6H3,(H,18,19)/t12-,13?,14?,15+/m1/s1 |
| InChIKey | ZIWFXJZTKLTFAZ-URGYJCLVSA-N |
| XLogP | 3.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|