C11H25NOSi — CID 170768326
3-[tert-butyl(dimethyl)silyl]oxy-N-methylcyclobutan-1-amine (PubChem CID 170768326) has the molecular formula C11H25NOSi and a molecular weight of 215.41 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-N-methylcyclobutan-1-amine.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-N-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 170768326 |
| Molecular Formula | C11H25NOSi |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-N-methylcyclobutan-1-amine |
| SMILES | CNC1CC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C11H25NOSi/c1-11(2,3)14(5,6)13-10-7-9(8-10)12-4/h9-10,12H,7-8H2,1-6H3 |
| InChIKey | SMHZZZFGTALCSM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|