C12H26O3Si — CID 11791488
cis-(1R,3S)-5-[tert-butyl(dimethyl)silyl]oxycyclohexane-1,3-diol (PubChem CID 11791488) has the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. Its IUPAC name is cis-(1R,3S)-5-[tert-butyl(dimethyl)silyl]oxycyclohexane-1,3-diol.
| Compound Name | cis-(1R,3S)-5-[tert-butyl(dimethyl)silyl]oxycyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11791488 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | cis-(1R,3S)-5-[tert-butyl(dimethyl)silyl]oxycyclohexane-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@@H](O)C[C@@H](O)C1 |
| InChI | InChI=1S/C12H26O3Si/c1-12(2,3)16(4,5)15-11-7-9(13)6-10(14)8-11/h9-11,13-14H,6-8H2,1-5H3/t9-,10+,11? |
| InChIKey | TTZSBYNDDVTMDO-ZACCUICWSA-N |
| XLogP | 2.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|