C11H24OSSi — CID 171781505
[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanethiol (PubChem CID 171781505) has the molecular formula C11H24OSSi and a molecular weight of 232.46 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanethiol.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanethiol |
|---|---|
| PubChem CID | 171781505 |
| Molecular Formula | C11H24OSSi |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanethiol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(CS)C1 |
| InChI | InChI=1S/C11H24OSSi/c1-11(2,3)14(4,5)12-10-6-9(7-10)8-13/h9-10,13H,6-8H2,1-5H3 |
| InChIKey | CPNUGUIQOUSDRG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|