C15H24Cl4OSi — CID 125029134
tert-butyl-dimethyl-[[(1R,2R,4R,8S)-3,3,9,9-tetrachloro-6-tricyclo[6.1.0.02,4]nonanyl]oxy]silane (PubChem CID 125029134) has the molecular formula C15H24Cl4OSi and a molecular weight of 390.25 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2R,4R,8S)-3,3,9,9-tetrachloro-6-tricyclo[6.1.0.02,4]nonanyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2R,4R,8S)-3,3,9,9-tetrachloro-6-tricyclo[6.1.0.02,4]nonanyl]oxy]silane |
|---|---|
| PubChem CID | 125029134 |
| Molecular Formula | C15H24Cl4OSi |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2R,4R,8S)-3,3,9,9-tetrachloro-6-tricyclo[6.1.0.02,4]nonanyl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@@H]2[C@H]([C@H]3[C@H](C1)C3(Cl)Cl)C2(Cl)Cl |
| InChI | InChI=1S/C15H24Cl4OSi/c1-13(2,3)21(4,5)20-8-6-9-11(14(9,16)17)12-10(7-8)15(12,18)19/h8-12H,6-7H2,1-5H3/t8?,9-,10+,11-,12-/m1/s1 |
| InChIKey | QEKNNVGSMWNWRH-UPUXHGCUSA-N |
| XLogP | 6.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|