C11H24NOSi- — CID 91868284
tert-butyl-dimethyl-[(3R,5R)-5-methylpyrrolidin-1-id-3-yl]oxysilane (PubChem CID 91868284) has the molecular formula C11H24NOSi- and a molecular weight of 214.40 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R,5R)-5-methylpyrrolidin-1-id-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R,5R)-5-methylpyrrolidin-1-id-3-yl]oxysilane |
|---|---|
| PubChem CID | 91868284 |
| Molecular Formula | C11H24NOSi- |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | tert-butyl-dimethyl-[(3R,5R)-5-methylpyrrolidin-1-id-3-yl]oxysilane |
| SMILES | C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[N-]1 |
| InChI | InChI=1S/C11H24NOSi/c1-9-7-10(8-12-9)13-14(5,6)11(2,3)4/h9-10H,7-8H2,1-6H3/q-1/t9-,10-/m1/s1 |
| InChIKey | BFAVETVFNJMZLQ-NXEZZACHSA-N |
| XLogP | 3.54 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|