C15H33NOSi — CID 141203202
tert-butyl-[(3R,5R)-1-tert-butyl-5-methylpyrrolidin-3-yl]oxy-dimethylsilane (PubChem CID 141203202) has the molecular formula C15H33NOSi and a molecular weight of 271.52 g/mol. Its IUPAC name is tert-butyl-[(3R,5R)-1-tert-butyl-5-methylpyrrolidin-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,5R)-1-tert-butyl-5-methylpyrrolidin-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 141203202 |
| Molecular Formula | C15H33NOSi |
| Molecular Weight | 271.52 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | tert-butyl-[(3R,5R)-1-tert-butyl-5-methylpyrrolidin-3-yl]oxy-dimethylsilane |
| SMILES | C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(C)(C)C |
| InChI | InChI=1S/C15H33NOSi/c1-12-10-13(11-16(12)14(2,3)4)17-18(8,9)15(5,6)7/h12-13H,10-11H2,1-9H3/t12-,13-/m1/s1 |
| InChIKey | BHPGNPFOERCSIQ-CHWSQXEVSA-N |
| XLogP | 4.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|