C9H18ClN — CID 153298890
(2R,4S)-1-tert-butyl-4-chloro-2-methylpyrrolidine (PubChem CID 153298890) has the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. Its IUPAC name is (2R,4S)-1-tert-butyl-4-chloro-2-methylpyrrolidine.
| Compound Name | (2R,4S)-1-tert-butyl-4-chloro-2-methylpyrrolidine |
|---|---|
| PubChem CID | 153298890 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (2R,4S)-1-tert-butyl-4-chloro-2-methylpyrrolidine |
| SMILES | C[C@@H]1C[C@H](Cl)CN1C(C)(C)C |
| InChI | InChI=1S/C9H18ClN/c1-7-5-8(10)6-11(7)9(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8+/m1/s1 |
| InChIKey | XUYKCGXCCLXUHS-SFYZADRCSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|