About 1-tert-butyl-2,4,6-trimethylazocane
1-tert-butyl-2,4,6-trimethylazocane (PubChem CID 166882089) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is 1-tert-butyl-2,4,6-trimethylazocane.
Molecular Properties
| Compound Name | 1-tert-butyl-2,4,6-trimethylazocane |
| PubChem CID | 166882089 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 1-tert-butyl-2,4,6-trimethylazocane |
| SMILES | CC1CCN(C(C)(C)C)C(C)CC(C)C1 |
| InChI | InChI=1S/C14H29N/c1-11-7-8-15(14(4,5)6)13(3)10-12(2)9-11/h11-13H,7-10H2,1-6H3 |
| InChIKey | QOPHRSFZXCFKSS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-2,4,6-trimethylazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2,4,6-trimethylazocane?
The IUPAC name of 1-tert-butyl-2,4,6-trimethylazocane (CID 166882089) is 1-tert-butyl-2,4,6-trimethylazocane.
What is the SMILES notation for 1-tert-butyl-2,4,6-trimethylazocane?
The canonical SMILES for 1-tert-butyl-2,4,6-trimethylazocane is CC1CCN(C(C)(C)C)C(C)CC(C)C1.
What is the InChIKey of 1-tert-butyl-2,4,6-trimethylazocane?
The InChIKey is QOPHRSFZXCFKSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N/c1-11-7-8-15(14(4,5)6)13(3)10-12(2)9-11/h11-13H,7-10H2,1-6H3.
What are the key properties of 1-tert-butyl-2,4,6-trimethylazocane?
1-tert-butyl-2,4,6-trimethylazocane has a molecular weight of 211.39 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2,4,6-trimethylazocane is sourced from PubChem (CID 166882089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).