C14H30N2 — CID 154614439
1,2-ditert-butyl-3,4-dimethyl-1,3-diazinane (PubChem CID 154614439) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 1,2-ditert-butyl-3,4-dimethyl-1,3-diazinane.
| Compound Name | 1,2-ditert-butyl-3,4-dimethyl-1,3-diazinane |
|---|---|
| PubChem CID | 154614439 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 1,2-ditert-butyl-3,4-dimethyl-1,3-diazinane |
| SMILES | CC1CCN(C(C)(C)C)C(C(C)(C)C)N1C |
| InChI | InChI=1S/C14H30N2/c1-11-9-10-16(14(5,6)7)12(15(11)8)13(2,3)4/h11-12H,9-10H2,1-8H3 |
| InChIKey | HIDNFGCXOHWDIV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |