C9H19N — CID 142119830
(2R,7S)-1,2,7-trimethylazepane (PubChem CID 142119830) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (2R,7S)-1,2,7-trimethylazepane.
| Compound Name | (2R,7S)-1,2,7-trimethylazepane |
|---|---|
| PubChem CID | 142119830 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (2R,7S)-1,2,7-trimethylazepane |
| SMILES | C[C@@H]1CCCC[C@H](C)N1C |
| InChI | InChI=1S/C9H19N/c1-8-6-4-5-7-9(2)10(8)3/h8-9H,4-7H2,1-3H3/t8-,9+ |
| InChIKey | XWVFVOHYEXHBHQ-DTORHVGOSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |