About 1,2,4,6-tetramethylpiperazine
1,2,4,6-tetramethylpiperazine (PubChem CID 22088083) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 1,2,4,6-tetramethylpiperazine.
Molecular Properties
| Compound Name | 1,2,4,6-tetramethylpiperazine |
| PubChem CID | 22088083 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1,2,4,6-tetramethylpiperazine |
| SMILES | CC1CN(C)CC(C)N1C |
| InChI | InChI=1S/C8H18N2/c1-7-5-9(3)6-8(2)10(7)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | XVJRVYONDJGSLX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2,4,6-tetramethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4,6-tetramethylpiperazine?
The IUPAC name of 1,2,4,6-tetramethylpiperazine (CID 22088083) is 1,2,4,6-tetramethylpiperazine.
What is the SMILES notation for 1,2,4,6-tetramethylpiperazine?
The canonical SMILES for 1,2,4,6-tetramethylpiperazine is CC1CN(C)CC(C)N1C.
What is the InChIKey of 1,2,4,6-tetramethylpiperazine?
The InChIKey is XVJRVYONDJGSLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-7-5-9(3)6-8(2)10(7)4/h7-8H,5-6H2,1-4H3.
What are the key properties of 1,2,4,6-tetramethylpiperazine?
1,2,4,6-tetramethylpiperazine has a molecular weight of 142.25 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4,6-tetramethylpiperazine is sourced from PubChem (CID 22088083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).