C8H18N2 — CID 22088083
1,2,4,6-tetramethylpiperazine (PubChem CID 22088083) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1,2,4,6-tetramethylpiperazine.
| Compound Name | 1,2,4,6-tetramethylpiperazine |
|---|---|
| PubChem CID | 22088083 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1,2,4,6-tetramethylpiperazine |
| SMILES | CC1CN(C)CC(C)N1C |
| InChI | InChI=1S/C8H18N2/c1-7-5-9(3)6-8(2)10(7)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | XVJRVYONDJGSLX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |