C17H38N2 — CID 142886839
1,2-dimethylpiperidine;ethane;1,2,6-trimethylpiperidine (PubChem CID 142886839) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 1,2-dimethylpiperidine;ethane;1,2,6-trimethylpiperidine.
| Compound Name | 1,2-dimethylpiperidine;ethane;1,2,6-trimethylpiperidine |
|---|---|
| PubChem CID | 142886839 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 1,2-dimethylpiperidine;ethane;1,2,6-trimethylpiperidine |
| SMILES | CC.CC1CCCC(C)N1C.CC1CCCCN1C |
| InChI | InChI=1S/C8H17N.C7H15N.C2H6/c1-7-5-4-6-8(2)9(7)3;1-7-5-3-4-6-8(7)2;1-2/h7-8H,4-6H2,1-3H3;7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | YKPAMTXUGQJMTA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |