C11H23N — CID 174662034
1,2-dimethylpyrrolidine;2-methylbut-2-ene (PubChem CID 174662034) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 1,2-dimethylpyrrolidine;2-methylbut-2-ene.
| Compound Name | 1,2-dimethylpyrrolidine;2-methylbut-2-ene |
|---|---|
| PubChem CID | 174662034 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1,2-dimethylpyrrolidine;2-methylbut-2-ene |
| SMILES | CC1CCCN1C.CC=C(C)C |
| InChI | InChI=1S/C6H13N.C5H10/c1-6-4-3-5-7(6)2;1-4-5(2)3/h6H,3-5H2,1-2H3;4H,1-3H3 |
| InChIKey | WMPMBZGBLONYKH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|