About (4R,7R)-1,7-dimethylazepan-4-ol
(4R,7R)-1,7-dimethylazepan-4-ol (PubChem CID 167089908) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is (4R,7R)-1,7-dimethylazepan-4-ol.
Molecular Properties
| Compound Name | (4R,7R)-1,7-dimethylazepan-4-ol |
| PubChem CID | 167089908 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (4R,7R)-1,7-dimethylazepan-4-ol |
| SMILES | C[C@@H]1CC[C@@H](O)CCN1C |
| InChI | InChI=1S/C8H17NO/c1-7-3-4-8(10)5-6-9(7)2/h7-8,10H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | DKYWQXPAZWULSI-HTQZYQBOSA-N |
| XLogP | 0.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R,7R)-1,7-dimethylazepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,7R)-1,7-dimethylazepan-4-ol?
The IUPAC name of (4R,7R)-1,7-dimethylazepan-4-ol (CID 167089908) is (4R,7R)-1,7-dimethylazepan-4-ol.
What is the SMILES notation for (4R,7R)-1,7-dimethylazepan-4-ol?
The canonical SMILES for (4R,7R)-1,7-dimethylazepan-4-ol is C[C@@H]1CC[C@@H](O)CCN1C.
What is the InChIKey of (4R,7R)-1,7-dimethylazepan-4-ol?
The InChIKey is DKYWQXPAZWULSI-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H17NO/c1-7-3-4-8(10)5-6-9(7)2/h7-8,10H,3-6H2,1-2H3/t7-,8-/m1/s1.
What are the key properties of (4R,7R)-1,7-dimethylazepan-4-ol?
(4R,7R)-1,7-dimethylazepan-4-ol has a molecular weight of 143.23 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,7R)-1,7-dimethylazepan-4-ol is sourced from PubChem (CID 167089908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).