About 1-methylpiperidin-4-ol;trihydrochloride
1-methylpiperidin-4-ol;trihydrochloride (PubChem CID 142686130) has the molecular formula C6H16Cl3NO
and a molecular weight of 224.56 g/mol. Its IUPAC name is 1-methylpiperidin-4-ol;trihydrochloride.
Molecular Properties
| Compound Name | 1-methylpiperidin-4-ol;trihydrochloride |
| PubChem CID | 142686130 |
| Molecular Formula | C6H16Cl3NO |
| Molecular Weight | 224.56 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 1-methylpiperidin-4-ol;trihydrochloride |
| SMILES | CN1CCC(O)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C6H13NO.3ClH/c1-7-4-2-6(8)3-5-7;;;/h6,8H,2-5H2,1H3;3*1H |
| InChIKey | UOLMJYIXAHHMCI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.56 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpiperidin-4-ol;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-4-ol;trihydrochloride?
The IUPAC name of 1-methylpiperidin-4-ol;trihydrochloride (CID 142686130) is 1-methylpiperidin-4-ol;trihydrochloride.
What is the SMILES notation for 1-methylpiperidin-4-ol;trihydrochloride?
The canonical SMILES for 1-methylpiperidin-4-ol;trihydrochloride is CN1CCC(O)CC1.Cl.Cl.Cl.
What is the InChIKey of 1-methylpiperidin-4-ol;trihydrochloride?
The InChIKey is UOLMJYIXAHHMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.3ClH/c1-7-4-2-6(8)3-5-7;;;/h6,8H,2-5H2,1H3;3*1H.
What are the key properties of 1-methylpiperidin-4-ol;trihydrochloride?
1-methylpiperidin-4-ol;trihydrochloride has a molecular weight of 224.56 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-4-ol;trihydrochloride is sourced from PubChem (CID 142686130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).