C9H19N — CID 89169089
(4R)-1,4,5-trimethylazepane (PubChem CID 89169089) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (4R)-1,4,5-trimethylazepane.
| Compound Name | (4R)-1,4,5-trimethylazepane |
|---|---|
| PubChem CID | 89169089 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (4R)-1,4,5-trimethylazepane |
| SMILES | CC1CCN(C)CC[C@H]1C |
| InChI | InChI=1S/C9H19N/c1-8-4-6-10(3)7-5-9(8)2/h8-9H,4-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | BHKOPRFGRJVEJU-VEDVMXKPSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |