C9H22N2 — CID 169133952
1,4-dimethylpiperidin-3-amine;ethane (PubChem CID 169133952) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is 1,4-dimethylpiperidin-3-amine;ethane.
| Compound Name | 1,4-dimethylpiperidin-3-amine;ethane |
|---|---|
| PubChem CID | 169133952 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 1,4-dimethylpiperidin-3-amine;ethane |
| SMILES | CC.CC1CCN(C)CC1N |
| InChI | InChI=1S/C7H16N2.C2H6/c1-6-3-4-9(2)5-7(6)8;1-2/h6-7H,3-5,8H2,1-2H3;1-2H3 |
| InChIKey | BXBYVTPBXDLFLD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |