C11H30N2 — CID 176946053
1,3-dimethylpiperidin-4-amine;ethane;molecular hydrogen (PubChem CID 176946053) has the molecular formula C11H30N2 and a molecular weight of 190.38 g/mol. Its IUPAC name is 1,3-dimethylpiperidin-4-amine;ethane;molecular hydrogen.
| Compound Name | 1,3-dimethylpiperidin-4-amine;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 176946053 |
| Molecular Formula | C11H30N2 |
| Molecular Weight | 190.38 g/mol |
| Exact Mass | 190.24 |
| IUPAC Name | 1,3-dimethylpiperidin-4-amine;ethane;molecular hydrogen |
| SMILES | CC.CC.CC1CN(C)CCC1N.[H][H] |
| InChI | InChI=1S/C7H16N2.2C2H6.H2/c1-6-5-9(2)4-3-7(6)8;2*1-2;/h6-7H,3-5,8H2,1-2H3;2*1-2H3;1H |
| InChIKey | JPDHYGJHJUAQPI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |