C8H17N — CID 14454423
1,3,4-trimethylpiperidine (PubChem CID 14454423) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is 1,3,4-trimethylpiperidine.
| Compound Name | 1,3,4-trimethylpiperidine |
|---|---|
| PubChem CID | 14454423 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 1,3,4-trimethylpiperidine |
| SMILES | CC1CCN(C)CC1C |
| InChI | InChI=1S/C8H17N/c1-7-4-5-9(3)6-8(7)2/h7-8H,4-6H2,1-3H3 |
| InChIKey | SGEACAMHETYOIB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |