C7H15N — CID 58622802
(3R,4R)-1,3,4-trimethylpyrrolidine (PubChem CID 58622802) has the molecular formula C7H15N and a molecular weight of 113.20 g/mol. Its IUPAC name is (3R,4R)-1,3,4-trimethylpyrrolidine.
| Compound Name | (3R,4R)-1,3,4-trimethylpyrrolidine |
|---|---|
| PubChem CID | 58622802 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | (3R,4R)-1,3,4-trimethylpyrrolidine |
| SMILES | C[C@H]1CN(C)C[C@@H]1C |
| InChI | InChI=1S/C7H15N/c1-6-4-8(3)5-7(6)2/h6-7H,4-5H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | SIBLCLDNTGUERI-BQBZGAKWSA-N |
| XLogP | 1.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |